![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| MBBS-PHASE-I-(RS4)-2019-ONWARDS.pdf | 2024-10-19 10:35 | 7.4M | |
| MBBS-PHASE-I-&-II -RS3).pdf | 2024-10-19 10:35 | 7.1M | |
| MBBS-PHASE-II-(RS4).pdf | 2024-10-19 10:35 | 3.8M | |
| Voter Helpline FMMC.pdf | 2024-10-19 10:35 | 3.3M | |
| MBBS-PHASE-III-PART-I-&-II-(RS3).pdf | 2024-10-19 10:35 | 2.6M | |
| CBME-Pre-Clinical- PG-PDF.pdf | 2024-10-19 10:35 | 1.7M | |
| M.Ch.-UROLOGY.pdf | 2024-10-19 10:35 | 1.4M | |
| MS-GENERAL-SURGERY.pdf | 2024-10-19 10:35 | 1.2M | |
| MD-GENERAL-MEDICINE.pdf | 2024-10-19 10:35 | 1.2M | |
| activity-report-form.pdf | 2024-10-19 10:35 | 1.2M | |
| MS-OPHTHALMOLOGY.pdf | 2024-10-19 10:35 | 1.2M | |
| MD-PAEDIATRICS.pdf | 2024-10-19 10:35 | 1.2M | |
| 2. Antiragging Posters.pdf | 2025-02-15 05:57 | 1.1M | |
| 4. UGC Antiragging Guidlines.pdf | 2025-02-15 05:57 | 1.0M | |
| MD-RADIO-DIAGNOSIS.pdf | 2024-10-19 10:35 | 938K | |
| MS-OBSTETRICS-&-GYNAECOLOGY.pdf | 2024-10-19 10:35 | 937K | |
| MD-RADIOTHERAPY.pdf | 2024-10-19 10:35 | 904K | |
| Father_Muller_Small_Book.pdf | 2024-11-04 05:28 | 877K | |
| Guidelines for attendance & other requirements for MBBS course.pdf | 2024-10-19 10:35 | 855K | |
| MD-DERMATOLOGY.pdf | 2024-10-19 10:35 | 850K | |
| MD-ANAESTHESIOLOGY.pdf | 2024-10-19 10:35 | 802K | |
| MS-OTO-RHINO-LARYNGOLOGY.pdf | 2024-10-19 10:35 | 794K | |
| MS-ORTHOPAEDICS.pdf | 2024-10-19 10:35 | 772K | |
| MD-PSYCHIATRY.pdf | 2024-10-19 10:35 | 768K | |
| DM-NEPHROLOGY.pdf | 2024-10-19 10:35 | 712K | |
| SSR1.pdf | 2024-10-19 10:35 | 710K | |
| Grade-Sheet-2nd-Cycle.pdf | 2024-10-19 10:35 | 557K | |
| DM-NEUROLOGY.pdf | 2024-10-19 10:35 | 511K | |
| Alumni-Medical.pdf | 2024-10-19 10:35 | 430K | |
| Code-of-conduct-for-Faculty-taff.pdf | 2024-10-19 10:35 | 334K | |
| Slogan pdf.pdf | 2024-10-19 10:35 | 317K | |
| Janet-Revised-details-biodata-website-fr-muller.pdf | 2024-10-19 10:35 | 314K | |
| DVV Clarification.pdf | 2024-10-19 10:35 | 274K | |
| 1. Curbing the Menace of Ragging.pdf | 2025-02-15 05:57 | 260K | |
| Anti Ragging-NMC Guidelines.pdf | 2024-10-19 10:35 | 184K | |
| PATHOLOGY.pdf | 2024-10-19 10:35 | 173K | |
| IIQA.pdf | 2024-10-19 10:35 | 102K | |
| MICROBIOLOGY.pdf | 2024-10-19 10:35 | 94K | |
| Hostel-code-of-conduct.pdf | 2024-10-19 10:35 | 88K | |
| College-Code-of-Conduct.pdf | 2024-10-19 10:35 | 81K | |
| PHARMACOLOGY.pdf | 2024-10-19 10:35 | 76K | |
| Enrolment link.pdf | 2024-10-19 10:35 | 75K | |
| Stipend details - Nov.pdf | 2024-12-12 05:19 | 59K | |
| stiphend-details.pdf | 2025-04-10 07:00 | 58K | |
| Stipend details.pdf | 2025-01-14 05:29 | 58K | |
| 2018.pdf | 2024-10-19 10:35 | 54K | |
| 2017.pdf | 2024-10-19 10:35 | 51K | |
| 2020.pdf | 2024-10-19 10:35 | 50K | |
| 2019.pdf | 2024-10-19 10:35 | 50K | |
| 2015.pdf | 2024-10-19 10:35 | 48K | |
| 2016.pdf | 2024-10-19 10:35 | 48K | |
| 2014.pdf | 2024-10-19 10:35 | 47K | |
| updates/ | 2025-03-10 07:43 | - | |
| publications/ | 2024-10-19 10:36 | - | |
| nirf/ | 2025-01-20 05:51 | - | |
| mci/ | 2024-11-30 05:24 | - | |
| iqac/ | 2024-11-19 07:27 | - | |